C19H11NO7 — CID 162658494
(8Z)-8-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione (PubChem CID 162658494) has the molecular formula C19H11NO7 and a molecular weight of 365.30 g/mol. Its IUPAC name is (8Z)-8-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione.
| Compound Name | (8Z)-8-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione |
|---|---|
| PubChem CID | 162658494 |
| Molecular Formula | C19H11NO7 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | (8Z)-8-[(3-hydroxy-4-nitrophenyl)methylidene]-4-methylfuro[2,3-h]chromene-2,9-dione |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)O/C(=C\c1ccc([N+](=O)[O-])c(O)c1)C3=O |
| InChI | InChI=1S/C19H11NO7/c1-9-6-16(22)27-19-11(9)3-5-14-17(19)18(23)15(26-14)8-10-2-4-12(20(24)25)13(21)7-10/h2-8,21H,1H3/b15-8- |
| InChIKey | RNIGDRFYYRCDDP-NVNXTCNLSA-N |
| XLogP | 3.33 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|