C28H49NO3 — CID 162658603
2-(2-propylpentanoylamino)ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 162658603) has the molecular formula C28H49NO3 and a molecular weight of 447.70 g/mol. Its IUPAC name is 2-(2-propylpentanoylamino)ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 2-(2-propylpentanoylamino)ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 162658603 |
| Molecular Formula | C28H49NO3 |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 447.37 |
| IUPAC Name | 2-(2-propylpentanoylamino)ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCCNC(=O)C(CCC)CCC |
| InChI | InChI=1S/C28H49NO3/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-27(30)32-25-24-29-28(31)26(21-5-2)22-6-3/h7-8,10-11,13-14,26H,4-6,9,12,15-25H2,1-3H3,(H,29,31)/b8-7-,11-10-,14-13- |
| InChIKey | BHDGVFDUSZUGHI-JPFHKJGASA-N |
| XLogP | 7.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|