C19H21NO4 — CID 162658719
2,3-dimethoxy-5,6,6a,7,12,12a-hexahydrobenzo[a]acridine-9,10-diol (PubChem CID 162658719) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2,3-dimethoxy-5,6,6a,7,12,12a-hexahydrobenzo[a]acridine-9,10-diol.
| Compound Name | 2,3-dimethoxy-5,6,6a,7,12,12a-hexahydrobenzo[a]acridine-9,10-diol |
|---|---|
| PubChem CID | 162658719 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2,3-dimethoxy-5,6,6a,7,12,12a-hexahydrobenzo[a]acridine-9,10-diol |
| SMILES | COc1cc2c(cc1OC)C1Cc3cc(O)c(O)cc3NC1CC2 |
| InChI | InChI=1S/C19H21NO4/c1-23-18-7-10-3-4-14-13(12(10)8-19(18)24-2)5-11-6-16(21)17(22)9-15(11)20-14/h6-9,13-14,20-22H,3-5H2,1-2H3 |
| InChIKey | MUAOWZOXUPYUNB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|