C20H26O4 — CID 162658736
(1R,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-1-hydroxy-3,4a,8,8-tetramethyl-1,5,6,8a-tetrahydronaphthalene-2,7-dione (PubChem CID 162658736) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1R,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-1-hydroxy-3,4a,8,8-tetramethyl-1,5,6,8a-tetrahydronaphthalene-2,7-dione.
| Compound Name | (1R,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-1-hydroxy-3,4a,8,8-tetramethyl-1,5,6,8a-tetrahydronaphthalene-2,7-dione |
|---|---|
| PubChem CID | 162658736 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1R,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-1-hydroxy-3,4a,8,8-tetramethyl-1,5,6,8a-tetrahydronaphthalene-2,7-dione |
| SMILES | CC1=C(CCc2ccoc2)[C@@]2(C)CCC(=O)C(C)(C)[C@@H]2[C@@H](O)C1=O |
| InChI | InChI=1S/C20H26O4/c1-12-14(6-5-13-8-10-24-11-13)20(4)9-7-15(21)19(2,3)18(20)17(23)16(12)22/h8,10-11,17-18,23H,5-7,9H2,1-4H3/t17-,18-,20+/m0/s1 |
| InChIKey | VBIUKBOBRCNLBZ-CMKODMSKSA-N |
| XLogP | 3.48 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |