C19H30O3 — CID 162658906
[(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-hydroxy-3-methylbutanoate (PubChem CID 162658906) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is [(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-hydroxy-3-methylbutanoate.
| Compound Name | [(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 162658906 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-hydroxy-3-methylbutanoate |
| SMILES | CC/C=C/C=C/C=C/C=C\CCCCOC(=O)[C@H](O)C(C)C |
| InChI | InChI=1S/C19H30O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-22-19(21)18(20)17(2)3/h5-12,17-18,20H,4,13-16H2,1-3H3/b6-5+,8-7+,10-9+,12-11-/t18-/m1/s1 |
| InChIKey | MFYVPBMNSAAFKP-SJXBUGQXSA-N |
| XLogP | 4.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|