C21H21ClN2O4 — CID 162658944
ethyl 11-chloro-13-[(2-methoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate (PubChem CID 162658944) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is ethyl 11-chloro-13-[(2-methoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate.
| Compound Name | ethyl 11-chloro-13-[(2-methoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 162658944 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | ethyl 11-chloro-13-[(2-methoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)c2c(n1Cc1ccccc1OC)-c1oncc1CCC2 |
| InChI | InChI=1S/C21H21ClN2O4/c1-3-27-21(25)19-17(22)15-9-6-8-13-11-23-28-20(13)18(15)24(19)12-14-7-4-5-10-16(14)26-2/h4-5,7,10-11H,3,6,8-9,12H2,1-2H3 |
| InChIKey | BPGHMWPXSBECGP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |