About 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole
5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole (PubChem CID 162658964) has the molecular formula C18H18N2S2
and a molecular weight of 326.49 g/mol. Its IUPAC name is 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole.
Molecular Properties
| Compound Name | 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole |
| PubChem CID | 162658964 |
| Molecular Formula | C18H18N2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole |
| SMILES | C=C(c1cc(SC)nc(SC)c1)c1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C18H18N2S2/c1-12(15-10-17(21-3)19-18(11-15)22-4)13-5-6-16-14(9-13)7-8-20(16)2/h5-11H,1H2,2-4H3 |
| InChIKey | MRKKHNYTGFLVOW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole?
The IUPAC name of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole (CID 162658964) is 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole.
What is the SMILES notation for 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole?
The canonical SMILES for 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole is C=C(c1cc(SC)nc(SC)c1)c1ccc2c(ccn2C)c1.
What is the InChIKey of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole?
The InChIKey is MRKKHNYTGFLVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2S2/c1-12(15-10-17(21-3)19-18(11-15)22-4)13-5-6-16-14(9-13)7-8-20(16)2/h5-11H,1H2,2-4H3.
What are the key properties of 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole?
5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole has a molecular weight of 326.49 g/mol, XLogP of 5.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[2,6-bis(methylsulfanyl)-4-pyridinyl]ethenyl]-1-methylindole is sourced from PubChem (CID 162658964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).