C29H20F2O6 — CID 162659139
dimethyl 4,9-bis(4-fluorophenyl)-5,8-dioxo-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate (PubChem CID 162659139) has the molecular formula C29H20F2O6 and a molecular weight of 502.47 g/mol. Its IUPAC name is dimethyl 4,9-bis(4-fluorophenyl)-5,8-dioxo-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate.
| Compound Name | dimethyl 4,9-bis(4-fluorophenyl)-5,8-dioxo-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 162659139 |
| Molecular Formula | C29H20F2O6 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | dimethyl 4,9-bis(4-fluorophenyl)-5,8-dioxo-1,3-dihydrocyclopenta[b]naphthalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(c(-c3ccc(F)cc3)c3c(c2-c2ccc(F)cc2)C(=O)C=CC3=O)C1 |
| InChI | InChI=1S/C29H20F2O6/c1-36-27(34)29(28(35)37-2)13-19-20(14-29)24(16-5-9-18(31)10-6-16)26-22(33)12-11-21(32)25(26)23(19)15-3-7-17(30)8-4-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | DQEWWOACCBNBKG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|