C21H32O5 — CID 162659166
4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2H-furan-5-one (PubChem CID 162659166) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162659166 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-[2-[(1R,3S,3aS,7aS)-1-methoxy-4,4,7a-trimethyl-3-propanoyl-3a,5,6,7-tetrahydro-3H-2-benzofuran-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CCC(=O)[C@H]1O[C@@](CCC2=CCOC2=O)(OC)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C21H32O5/c1-6-15(22)16-17-19(2,3)10-7-11-20(17,4)21(24-5,26-16)12-8-14-9-13-25-18(14)23/h9,16-17H,6-8,10-13H2,1-5H3/t16-,17+,20+,21-/m1/s1 |
| InChIKey | HHWUQHDMJSKVOC-SQBLYHGDSA-N |
| XLogP | 3.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |