About 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole
5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole (PubChem CID 162659271) has the molecular formula C17H18FN5O
and a molecular weight of 327.36 g/mol. Its IUPAC name is 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole.
Molecular Properties
| Compound Name | 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole |
| PubChem CID | 162659271 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole |
| SMILES | Cc1[nH]nc2ccc(-c3cncc(O[C@H]4CCNC[C@@H]4F)n3)cc12 |
| InChI | InChI=1S/C17H18FN5O/c1-10-12-6-11(2-3-14(12)23-22-10)15-8-20-9-17(21-15)24-16-4-5-19-7-13(16)18/h2-3,6,8-9,13,16,19H,4-5,7H2,1H3,(H,22,23)/t13-,16-/m0/s1 |
| InChIKey | HTCIBTAIOFZTOM-BBRMVZONSA-N |
| XLogP | 2.41 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole?
The IUPAC name of 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole (CID 162659271) is 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole.
What is the SMILES notation for 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole?
The canonical SMILES for 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole is Cc1[nH]nc2ccc(-c3cncc(O[C@H]4CCNC[C@@H]4F)n3)cc12.
What is the InChIKey of 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole?
The InChIKey is HTCIBTAIOFZTOM-BBRMVZONSA-N. The full InChI is InChI=1S/C17H18FN5O/c1-10-12-6-11(2-3-14(12)23-22-10)15-8-20-9-17(21-15)24-16-4-5-19-7-13(16)18/h2-3,6,8-9,13,16,19H,4-5,7H2,1H3,(H,22,23)/t13-,16-/m0/s1.
What are the key properties of 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole?
5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole has a molecular weight of 327.36 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyrazin-2-yl]-3-methyl-2H-indazole is sourced from PubChem (CID 162659271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).