About 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol
4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol (PubChem CID 162659597) has the molecular formula C20H15N5O
and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol |
| PubChem CID | 162659597 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol |
| SMILES | Cn1ncc2cccc(-c3cn4c(-c5ccc(O)cc5)cnc4cn3)c21 |
| InChI | InChI=1S/C20H15N5O/c1-24-20-14(9-23-24)3-2-4-16(20)17-12-25-18(10-22-19(25)11-21-17)13-5-7-15(26)8-6-13/h2-12,26H,1H3 |
| InChIKey | DUVPAVPRSUHQFD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol?
The IUPAC name of 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol (CID 162659597) is 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol.
What is the SMILES notation for 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol?
The canonical SMILES for 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol is Cn1ncc2cccc(-c3cn4c(-c5ccc(O)cc5)cnc4cn3)c21.
What is the InChIKey of 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol?
The InChIKey is DUVPAVPRSUHQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O/c1-24-20-14(9-23-24)3-2-4-16(20)17-12-25-18(10-22-19(25)11-21-17)13-5-7-15(26)8-6-13/h2-12,26H,1H3.
What are the key properties of 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol?
4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol has a molecular weight of 341.37 g/mol, XLogP of 3.66, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(1-methylindazol-7-yl)imidazo[1,2-a]pyrazin-3-yl]phenol is sourced from PubChem (CID 162659597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).