C42H33BrN2O3 — CID 162659765
2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide (PubChem CID 162659765) has the molecular formula C42H33BrN2O3 and a molecular weight of 693.64 g/mol. Its IUPAC name is 2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide.
| Compound Name | 2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide |
|---|---|
| PubChem CID | 162659765 |
| Molecular Formula | C42H33BrN2O3 |
| Molecular Weight | 693.64 g/mol |
| Exact Mass | 692.17 |
| IUPAC Name | 2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide |
| SMILES | Cc1cc2c(cc1C)[n+](CC(=O)c1ccc(-c3ccccc3)cc1)cn2CC=C(c1cc2ccccc2o1)c1cc2ccccc2o1.[Br-] |
| InChI | InChI=1S/C42H33N2O3.BrH/c1-28-22-36-37(23-29(28)2)44(26-38(45)32-18-16-31(17-19-32)30-10-4-3-5-11-30)27-43(36)21-20-35(41-24-33-12-6-8-14-39(33)46-41)42-25-34-13-7-9-15-40(34)47-42;/h3-20,22-25,27H,21,26H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SPRMLYWQONCDNW-UHFFFAOYSA-M |
| XLogP | 6.72 |
| TPSA | 52.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|