C34H24BF2I2N3 — CID 162659988
2,2-difluoro-5,11-diiodo-4,12-bis(4-methylphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 162659988) has the molecular formula C34H24BF2I2N3 and a molecular weight of 777.20 g/mol. Its IUPAC name is 2,2-difluoro-5,11-diiodo-4,12-bis(4-methylphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-5,11-diiodo-4,12-bis(4-methylphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 162659988 |
| Molecular Formula | C34H24BF2I2N3 |
| Molecular Weight | 777.20 g/mol |
| Exact Mass | 777.01 |
| IUPAC Name | 2,2-difluoro-5,11-diiodo-4,12-bis(4-methylphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1ccc(C2=[N+]3C(=Nc4c(-c5ccccc5)c(I)c(-c5ccc(C)cc5)n4[B-]3(F)F)C(c3ccccc3)=C2I)cc1 |
| InChI | InChI=1S/C34H24BF2I2N3/c1-21-13-17-25(18-14-21)31-29(38)27(23-9-5-3-6-10-23)33-40-34-28(24-11-7-4-8-12-24)30(39)32(26-19-15-22(2)16-20-26)42(34)35(36,37)41(31)33/h3-20H,1-2H3 |
| InChIKey | RACOBYLCIYKTAM-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.20 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|