About 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine
5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine (PubChem CID 162660010) has the molecular formula C22H20N2O2S
and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine |
| PubChem CID | 162660010 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine |
| SMILES | COc1ccc(/C=C/C2=CC(c3ccc(OC)cc3)N3C=CSC3=N2)cc1 |
| InChI | InChI=1S/C22H20N2O2S/c1-25-19-9-4-16(5-10-19)3-8-18-15-21(24-13-14-27-22(24)23-18)17-6-11-20(26-2)12-7-17/h3-15,21H,1-2H3/b8-3+ |
| InChIKey | HRCKOJIEKGYZMW-FPYGCLRLSA-N |
| XLogP | 5.23 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine?
The IUPAC name of 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine (CID 162660010) is 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine.
What is the SMILES notation for 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine?
The canonical SMILES for 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine is COc1ccc(/C=C/C2=CC(c3ccc(OC)cc3)N3C=CSC3=N2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine?
The InChIKey is HRCKOJIEKGYZMW-FPYGCLRLSA-N. The full InChI is InChI=1S/C22H20N2O2S/c1-25-19-9-4-16(5-10-19)3-8-18-15-21(24-13-14-27-22(24)23-18)17-6-11-20(26-2)12-7-17/h3-15,21H,1-2H3/b8-3+.
What are the key properties of 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine?
5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine has a molecular weight of 376.48 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-7-[(E)-2-(4-methoxyphenyl)ethenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine is sourced from PubChem (CID 162660010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).