About 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one
3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one (PubChem CID 162660199) has the molecular formula C16H17ClN4OS
and a molecular weight of 348.86 g/mol. Its IUPAC name is 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one |
| PubChem CID | 162660199 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one |
| SMILES | CCCCNc1ncc(Cn2cnc3ccc(Cl)cc3c2=O)s1 |
| InChI | InChI=1S/C16H17ClN4OS/c1-2-3-6-18-16-19-8-12(23-16)9-21-10-20-14-5-4-11(17)7-13(14)15(21)22/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,18,19) |
| InChIKey | CUANSBRTPIETTO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one?
The IUPAC name of 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one (CID 162660199) is 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one.
What is the SMILES notation for 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one?
The canonical SMILES for 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one is CCCCNc1ncc(Cn2cnc3ccc(Cl)cc3c2=O)s1.
What is the InChIKey of 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one?
The InChIKey is CUANSBRTPIETTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN4OS/c1-2-3-6-18-16-19-8-12(23-16)9-21-10-20-14-5-4-11(17)7-13(14)15(21)22/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,18,19).
What are the key properties of 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one?
3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one has a molecular weight of 348.86 g/mol, XLogP of 3.77, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(butylamino)-1,3-thiazol-5-yl]methyl]-6-chloroquinazolin-4-one is sourced from PubChem (CID 162660199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).