C20H21FN6O — CID 162660259
1-[4-[[4-amino-5-(5-fluoro-2-pyridinyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 162660259) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-[4-[[4-amino-5-(5-fluoro-2-pyridinyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[4-amino-5-(5-fluoro-2-pyridinyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162660259 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[4-[[4-amino-5-(5-fluoro-2-pyridinyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Cn2cc(-c3ccc(F)cn3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C20H21FN6O/c1-2-17(28)26-7-5-13(6-8-26)10-27-11-15(16-4-3-14(21)9-23-16)18-19(22)24-12-25-20(18)27/h2-4,9,11-13H,1,5-8,10H2,(H2,22,24,25) |
| InChIKey | ZQJKZGZEZRDJCC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|