C21H16N2O5S — CID 162660277
N-hydroxy-2-phenyl-4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide (PubChem CID 162660277) has the molecular formula C21H16N2O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is N-hydroxy-2-phenyl-4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide.
| Compound Name | N-hydroxy-2-phenyl-4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 162660277 |
| Molecular Formula | C21H16N2O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | N-hydroxy-2-phenyl-4-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)c3ccccc3S2(=O)=O)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H16N2O5S/c24-20(22-26)16-11-10-14(12-18(16)15-6-2-1-3-7-15)13-23-21(25)17-8-4-5-9-19(17)29(23,27)28/h1-12,26H,13H2,(H,22,24) |
| InChIKey | XYLVZKXNIYAIQC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|