C14H13ClN2O3S — CID 162660361
7-(3-chlorophenyl)-5-cyclopropyl-3,4-dihydrooxathiino[6,5-c]pyrazole 2,2-dioxide (PubChem CID 162660361) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-5-cyclopropyl-3,4-dihydrooxathiino[6,5-c]pyrazole 2,2-dioxide.
| Compound Name | 7-(3-chlorophenyl)-5-cyclopropyl-3,4-dihydrooxathiino[6,5-c]pyrazole 2,2-dioxide |
|---|---|
| PubChem CID | 162660361 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 7-(3-chlorophenyl)-5-cyclopropyl-3,4-dihydrooxathiino[6,5-c]pyrazole 2,2-dioxide |
| SMILES | O=S1(=O)CCc2c(C3CC3)nn(-c3cccc(Cl)c3)c2O1 |
| InChI | InChI=1S/C14H13ClN2O3S/c15-10-2-1-3-11(8-10)17-14-12(6-7-21(18,19)20-14)13(16-17)9-4-5-9/h1-3,8-9H,4-7H2 |
| InChIKey | STLYXQDWVKOWNJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|