C19H18Cl2N4O3S — CID 162660507
4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 162660507) has the molecular formula C19H18Cl2N4O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is 4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 162660507 |
| Molecular Formula | C19H18Cl2N4O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(Cc2n[nH]c(=S)n2/N=C\c2cccc(Cl)c2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C19H18Cl2N4O3S/c1-26-14-7-11(8-15(27-2)18(14)28-3)9-16-23-24-19(29)25(16)22-10-12-5-4-6-13(20)17(12)21/h4-8,10H,9H2,1-3H3,(H,24,29)/b22-10- |
| InChIKey | UIIQTKRZMOZGAC-YVNNLAQVSA-N |
| XLogP | 4.75 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|