C27H36N6O3S — CID 162660603
N-[1-[4-[2-(dimethylamino)ethylcarbamoyl]-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide (PubChem CID 162660603) has the molecular formula C27H36N6O3S and a molecular weight of 524.69 g/mol. Its IUPAC name is N-[1-[4-[2-(dimethylamino)ethylcarbamoyl]-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-[4-[2-(dimethylamino)ethylcarbamoyl]-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 162660603 |
| Molecular Formula | C27H36N6O3S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | N-[1-[4-[2-(dimethylamino)ethylcarbamoyl]-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCC(=O)CCCCCC(NC(=O)c1cncs1)c1[nH]c(-c2ccccc2)nc1C(=O)NCCN(C)C |
| InChI | InChI=1S/C27H36N6O3S/c1-4-20(34)13-9-6-10-14-21(30-26(35)22-17-28-18-37-22)23-24(27(36)29-15-16-33(2)3)32-25(31-23)19-11-7-5-8-12-19/h5,7-8,11-12,17-18,21H,4,6,9-10,13-16H2,1-3H3,(H,29,36)(H,30,35)(H,31,32) |
| InChIKey | DPINOTMBVJNBFU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|