C18H18N4O4 — CID 162660870
methyl 7,10-dioxa-13,17,18,21-tetrazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-5-carboxylate (PubChem CID 162660870) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is methyl 7,10-dioxa-13,17,18,21-tetrazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-5-carboxylate.
| Compound Name | methyl 7,10-dioxa-13,17,18,21-tetrazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 162660870 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl 7,10-dioxa-13,17,18,21-tetrazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaene-5-carboxylate |
| SMILES | COC(=O)c1ccc2cc1OCCOCCNc1ccn3ncc-2c3n1 |
| InChI | InChI=1S/C18H18N4O4/c1-24-18(23)13-3-2-12-10-15(13)26-9-8-25-7-5-19-16-4-6-22-17(21-16)14(12)11-20-22/h2-4,6,10-11H,5,7-9H2,1H3,(H,19,21) |
| InChIKey | JHECKRVNOFUEMM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |