C17H16ClFN4O4 — CID 162660943
(2S,3R,4S,5R)-2-[4-amino-5-(4-chloro-3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 162660943) has the molecular formula C17H16ClFN4O4 and a molecular weight of 394.79 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[4-amino-5-(4-chloro-3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-[4-amino-5-(4-chloro-3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 162660943 |
| Molecular Formula | C17H16ClFN4O4 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (2S,3R,4S,5R)-2-[4-amino-5-(4-chloro-3-fluorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)cc(-c3ccc(Cl)c(F)c3)c12 |
| InChI | InChI=1S/C17H16ClFN4O4/c18-9-2-1-7(3-10(9)19)8-4-11(23-13(8)17(20)21-6-22-23)16-15(26)14(25)12(5-24)27-16/h1-4,6,12,14-16,24-26H,5H2,(H2,20,21,22)/t12-,14-,15-,16+/m1/s1 |
| InChIKey | FHJSKLBGUASGGT-MIGQKNRLSA-N |
| XLogP | 0.93 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |