About 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol
1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol (PubChem CID 162661105) has the molecular formula C34H36N2O2
and a molecular weight of 504.67 g/mol. Its IUPAC name is 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
| PubChem CID | 162661105 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
| SMILES | C/C(=C(/c1ccccc1)c1ccc(OCC(O)CN2CCN(c3ccccc3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H36N2O2/c1-27(28-11-5-2-6-12-28)34(29-13-7-3-8-14-29)30-17-19-33(20-18-30)38-26-32(37)25-35-21-23-36(24-22-35)31-15-9-4-10-16-31/h2-20,32,37H,21-26H2,1H3/b34-27+ |
| InChIKey | SISGLKUXCHPGFV-DNGXXSEMSA-N |
| XLogP | 6.23 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol?
The IUPAC name of 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol (CID 162661105) is 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol.
What is the SMILES notation for 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol?
The canonical SMILES for 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol is C/C(=C(/c1ccccc1)c1ccc(OCC(O)CN2CCN(c3ccccc3)CC2)cc1)c1ccccc1.
What is the InChIKey of 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol?
The InChIKey is SISGLKUXCHPGFV-DNGXXSEMSA-N. The full InChI is InChI=1S/C34H36N2O2/c1-27(28-11-5-2-6-12-28)34(29-13-7-3-8-14-29)30-17-19-33(20-18-30)38-26-32(37)25-35-21-23-36(24-22-35)31-15-9-4-10-16-31/h2-20,32,37H,21-26H2,1H3/b34-27+.
What are the key properties of 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol?
1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol has a molecular weight of 504.67 g/mol, XLogP of 6.23, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-3-(4-phenylpiperazin-1-yl)propan-2-ol is sourced from PubChem (CID 162661105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).