C17H17ClN4O3 — CID 162661116
(2S,3R,5S)-2-[4-amino-5-(4-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 162661116) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is (2S,3R,5S)-2-[4-amino-5-(4-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R,5S)-2-[4-amino-5-(4-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 162661116 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2S,3R,5S)-2-[4-amino-5-(4-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](CO)C[C@H]3O)cc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C17H17ClN4O3/c18-10-3-1-9(2-4-10)12-6-13(16-14(24)5-11(7-23)25-16)22-15(12)17(19)20-8-21-22/h1-4,6,8,11,14,16,23-24H,5,7H2,(H2,19,20,21)/t11-,14+,16-/m0/s1 |
| InChIKey | CKMPQYCZOQCRDI-PEYYIBSZSA-N |
| XLogP | 1.82 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |