About disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid
disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid (PubChem CID 162661345) has the molecular formula C4H7N3Na2O7P2
and a molecular weight of 317.04 g/mol. Its IUPAC name is disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid.
Molecular Properties
| Compound Name | disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid |
| PubChem CID | 162661345 |
| Molecular Formula | C4H7N3Na2O7P2 |
| Molecular Weight | 317.04 g/mol |
| Exact Mass | 316.96 |
| IUPAC Name | disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid |
| SMILES | O=P([O-])([O-])C(O)(Cn1ccnn1)P(=O)(O)O.[Na+].[Na+] |
| InChI | InChI=1S/C4H9N3O7P2.2Na/c8-4(15(9,10)11,16(12,13)14)3-7-2-1-5-6-7;;/h1-2,8H,3H2,(H2,9,10,11)(H2,12,13,14);;/q;2*+1/p-2 |
| InChIKey | OICPOLIVDZIGII-UHFFFAOYSA-L |
| XLogP | -8.98 |
| TPSA | 171.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.04 |
| LogP ≤ 5 | -8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid?
The IUPAC name of disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid (CID 162661345) is disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid.
What is the SMILES notation for disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid?
The canonical SMILES for disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid is O=P([O-])([O-])C(O)(Cn1ccnn1)P(=O)(O)O.[Na+].[Na+].
What is the InChIKey of disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid?
The InChIKey is OICPOLIVDZIGII-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H9N3O7P2.2Na/c8-4(15(9,10)11,16(12,13)14)3-7-2-1-5-6-7;;/h1-2,8H,3H2,(H2,9,10,11)(H2,12,13,14);;/q;2*+1/p-2.
What are the key properties of disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid?
disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid has a molecular weight of 317.04 g/mol, XLogP of -8.98, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[1-hydroxy-1-phosphonato-2-(triazol-1-yl)ethyl]phosphonic acid is sourced from PubChem (CID 162661345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).