About 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one
7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one (PubChem CID 162661389) has the molecular formula C21H22ClNO2
and a molecular weight of 355.87 g/mol. Its IUPAC name is 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one.
Molecular Properties
| Compound Name | 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one |
| PubChem CID | 162661389 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one |
| SMILES | CC(C)=CCC1(C)C=Cc2c(c(-c3ccc(C)cc3)c(Cl)[nH]c2=O)O1 |
| InChI | InChI=1S/C21H22ClNO2/c1-13(2)9-11-21(4)12-10-16-18(25-21)17(19(22)23-20(16)24)15-7-5-14(3)6-8-15/h5-10,12H,11H2,1-4H3,(H,23,24) |
| InChIKey | NGTCXVOTXAKPER-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one?
The IUPAC name of 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one (CID 162661389) is 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one.
What is the SMILES notation for 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one?
The canonical SMILES for 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one is CC(C)=CCC1(C)C=Cc2c(c(-c3ccc(C)cc3)c(Cl)[nH]c2=O)O1.
What is the InChIKey of 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one?
The InChIKey is NGTCXVOTXAKPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO2/c1-13(2)9-11-21(4)12-10-16-18(25-21)17(19(22)23-20(16)24)15-7-5-14(3)6-8-15/h5-10,12H,11H2,1-4H3,(H,23,24).
What are the key properties of 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one?
7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one has a molecular weight of 355.87 g/mol, XLogP of 5.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-methyl-2-(3-methylbut-2-enyl)-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one is sourced from PubChem (CID 162661389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).