About 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid
6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid (PubChem CID 162661442) has the molecular formula C17H13F2N3O3
and a molecular weight of 345.31 g/mol. Its IUPAC name is 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid |
| PubChem CID | 162661442 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid |
| SMILES | CC(=O)Nc1cc(Nc2ccc(F)c(F)c2)c2cc(C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C17H13F2N3O3/c1-8(23)20-10-5-14(21-9-2-3-12(18)13(19)4-9)11-7-16(17(24)25)22-15(11)6-10/h2-7,21-22H,1H3,(H,20,23)(H,24,25) |
| InChIKey | VEGNPZGDQMNPKB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid?
The IUPAC name of 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid (CID 162661442) is 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid.
What is the SMILES notation for 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid?
The canonical SMILES for 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid is CC(=O)Nc1cc(Nc2ccc(F)c(F)c2)c2cc(C(=O)O)[nH]c2c1.
What is the InChIKey of 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid?
The InChIKey is VEGNPZGDQMNPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N3O3/c1-8(23)20-10-5-14(21-9-2-3-12(18)13(19)4-9)11-7-16(17(24)25)22-15(11)6-10/h2-7,21-22H,1H3,(H,20,23)(H,24,25).
What are the key properties of 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid?
6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid has a molecular weight of 345.31 g/mol, XLogP of 3.85, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetamido-4-(3,4-difluoroanilino)-1H-indole-2-carboxylic acid is sourced from PubChem (CID 162661442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).