C19H26O2 — CID 162661526
(5S,6S,8R,9S,10R,13S,14S)-6-hydroxy-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 162661526) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (5S,6S,8R,9S,10R,13S,14S)-6-hydroxy-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (5S,6S,8R,9S,10R,13S,14S)-6-hydroxy-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 162661526 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (5S,6S,8R,9S,10R,13S,14S)-6-hydroxy-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC=CC[C@@H]1[C@@H](O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C=C[C@@H]12 |
| InChI | InChI=1S/C19H26O2/c1-18-9-4-3-5-15(18)16(20)11-12-13-6-7-17(21)19(13,2)10-8-14(12)18/h3-4,6-7,12-16,20H,5,8-11H2,1-2H3/t12-,13-,14-,15+,16-,18+,19-/m0/s1 |
| InChIKey | HTDATMAZKKAVNN-NPFZYRJPSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|