C24H20BrN3S — CID 162661577
(Z)-N-[(E)-1-(3-bromophenyl)propylideneamino]-3,4-diphenyl-1,3-thiazol-2-imine (PubChem CID 162661577) has the molecular formula C24H20BrN3S and a molecular weight of 462.42 g/mol. Its IUPAC name is (Z)-N-[(E)-1-(3-bromophenyl)propylideneamino]-3,4-diphenyl-1,3-thiazol-2-imine.
| Compound Name | (Z)-N-[(E)-1-(3-bromophenyl)propylideneamino]-3,4-diphenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 162661577 |
| Molecular Formula | C24H20BrN3S |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (Z)-N-[(E)-1-(3-bromophenyl)propylideneamino]-3,4-diphenyl-1,3-thiazol-2-imine |
| SMILES | CC/C(=N\N=c1/scc(-c2ccccc2)n1-c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C24H20BrN3S/c1-2-22(19-12-9-13-20(25)16-19)26-27-24-28(21-14-7-4-8-15-21)23(17-29-24)18-10-5-3-6-11-18/h3-17H,2H2,1H3/b26-22+,27-24- |
| InChIKey | WLQUHTBUBBCZQQ-VMYVUXIHSA-N |
| XLogP | 6.68 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|