C26H27N3O3 — CID 162661703
N-[2-[[2-hydroxy-4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide (PubChem CID 162661703) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-[[2-hydroxy-4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[2-hydroxy-4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 162661703 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[2-[[2-hydroxy-4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1ccc(C(=O)N2CCc3c(-c4ccccc4)cccc32)cc1O |
| InChI | InChI=1S/C26H27N3O3/c1-18(30)28-14-13-27-17-21-11-10-20(16-25(21)31)26(32)29-15-12-23-22(8-5-9-24(23)29)19-6-3-2-4-7-19/h2-11,16,27,31H,12-15,17H2,1H3,(H,28,30) |
| InChIKey | WGODIFXEADMYAH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|