About 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane
1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane (PubChem CID 162661759) has the molecular formula C24H25F3O2
and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane.
Molecular Properties
| Compound Name | 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane |
| PubChem CID | 162661759 |
| Molecular Formula | C24H25F3O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane |
| SMILES | COc1ccc(-c2c(F)cc(F)c(OC)c2F)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H25F3O2/c1-28-20-4-3-16(21-18(25)9-19(26)23(29-2)22(21)27)8-17(20)24-10-13-5-14(11-24)7-15(6-13)12-24/h3-4,8-9,13-15H,5-7,10-12H2,1-2H3 |
| InChIKey | FBXNBVCRSPHOBP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane?
The IUPAC name of 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane (CID 162661759) is 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane.
What is the SMILES notation for 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane?
The canonical SMILES for 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane is COc1ccc(-c2c(F)cc(F)c(OC)c2F)cc1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane?
The InChIKey is FBXNBVCRSPHOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F3O2/c1-28-20-4-3-16(21-18(25)9-19(26)23(29-2)22(21)27)8-17(20)24-10-13-5-14(11-24)7-15(6-13)12-24/h3-4,8-9,13-15H,5-7,10-12H2,1-2H3.
What are the key properties of 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane?
1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane has a molecular weight of 402.46 g/mol, XLogP of 6.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-methoxy-5-(2,4,6-trifluoro-3-methoxyphenyl)phenyl]adamantane is sourced from PubChem (CID 162661759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).