C27H25F3N6S2 — CID 162661864
N-[(Z)-[1-[1-ethyl-5-[4-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine (PubChem CID 162661864) has the molecular formula C27H25F3N6S2 and a molecular weight of 554.67 g/mol. Its IUPAC name is N-[(Z)-[1-[1-ethyl-5-[4-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-[1-[1-ethyl-5-[4-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162661864 |
| Molecular Formula | C27H25F3N6S2 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | N-[(Z)-[1-[1-ethyl-5-[4-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine |
| SMILES | CCn1cc(/C(=N/Nc2nc3ccccc3s2)C(F)(F)F)c2cc(-c3nc(CN4CCCC4)cs3)ccc21 |
| InChI | InChI=1S/C27H25F3N6S2/c1-2-36-15-20(24(27(28,29)30)33-34-26-32-21-7-3-4-8-23(21)38-26)19-13-17(9-10-22(19)36)25-31-18(16-37-25)14-35-11-5-6-12-35/h3-4,7-10,13,15-16H,2,5-6,11-12,14H2,1H3,(H,32,34)/b33-24- |
| InChIKey | SLLJGGCSHDXKPT-GIBOGKFOSA-N |
| XLogP | 7.37 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|