About N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide
N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide (PubChem CID 162661949) has the molecular formula C22H23NO4S
and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide |
| PubChem CID | 162661949 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(CN(C(=O)Cc2cccs2)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-25-18-9-6-16(7-10-18)15-23(22(24)14-19-5-4-12-28-19)17-8-11-20(26-2)21(13-17)27-3/h4-13H,14-15H2,1-3H3 |
| InChIKey | YLXARSNFPFJVNX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide?
The IUPAC name of N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide (CID 162661949) is N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide?
The canonical SMILES for N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide is COc1ccc(CN(C(=O)Cc2cccs2)c2ccc(OC)c(OC)c2)cc1.
What is the InChIKey of N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide?
The InChIKey is YLXARSNFPFJVNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO4S/c1-25-18-9-6-16(7-10-18)15-23(22(24)14-19-5-4-12-28-19)17-8-11-20(26-2)21(13-17)27-3/h4-13H,14-15H2,1-3H3.
What are the key properties of N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide?
N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide has a molecular weight of 397.50 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]-2-thiophen-2-ylacetamide is sourced from PubChem (CID 162661949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).