C22H18O9 — CID 162662101
[(2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-3,4-dihydro-2H-chromen-7-yl] 3,4,5-trihydroxybenzoate (PubChem CID 162662101) has the molecular formula C22H18O9 and a molecular weight of 426.38 g/mol. Its IUPAC name is [(2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-3,4-dihydro-2H-chromen-7-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-3,4-dihydro-2H-chromen-7-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 162662101 |
| Molecular Formula | C22H18O9 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [(2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-3,4-dihydro-2H-chromen-7-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1cc(O)c2c(c1)O[C@@H](c1ccc(O)c(O)c1)CC2)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H18O9/c23-14-3-1-10(5-16(14)25)19-4-2-13-15(24)8-12(9-20(13)31-19)30-22(29)11-6-17(26)21(28)18(27)7-11/h1,3,5-9,19,23-28H,2,4H2/t19-/m1/s1 |
| InChIKey | NVRXFMBHGMQBOP-LJQANCHMSA-N |
| XLogP | 3.21 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|