About 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide
2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide (PubChem CID 162662202) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide |
| PubChem CID | 162662202 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)n1c(-c2ccccc2)coc1=O |
| InChI | InChI=1S/C20H20N2O3/c23-19(21-14-8-7-11-16-9-3-1-4-10-16)22-18(15-25-20(22)24)17-12-5-2-6-13-17/h1-6,9-10,12-13,15H,7-8,11,14H2,(H,21,23) |
| InChIKey | YXQGVMQWSDJOAC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide?
The IUPAC name of 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide (CID 162662202) is 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide.
What is the SMILES notation for 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide?
The canonical SMILES for 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide is O=C(NCCCCc1ccccc1)n1c(-c2ccccc2)coc1=O.
What is the InChIKey of 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide?
The InChIKey is YXQGVMQWSDJOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3/c23-19(21-14-8-7-11-16-9-3-1-4-10-16)22-18(15-25-20(22)24)17-12-5-2-6-13-17/h1-6,9-10,12-13,15H,7-8,11,14H2,(H,21,23).
What are the key properties of 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide?
2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide has a molecular weight of 336.39 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4-phenyl-N-(4-phenylbutyl)-1,3-oxazole-3-carboxamide is sourced from PubChem (CID 162662202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).