C37H12F14N4 — CID 162662283
5,15-bis(2,3,4,5,6-pentafluorophenyl)-10-(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin (PubChem CID 162662283) has the molecular formula C37H12F14N4 and a molecular weight of 778.50 g/mol. Its IUPAC name is 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10-(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10-(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 162662283 |
| Molecular Formula | C37H12F14N4 |
| Molecular Weight | 778.50 g/mol |
| Exact Mass | 778.08 |
| IUPAC Name | 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10-(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1cc(F)c(F)c(-c2c3ccc([nH]3)c(-c3c(F)c(F)c(F)c(F)c3F)c3nc(c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc2[nH]4)C=C3)c1F |
| InChI | InChI=1S/C37H12F14N4/c38-10-9-11(39)27(41)23(26(10)40)20-16-5-7-18(54-16)21(24-28(42)32(46)36(50)33(47)29(24)43)14-3-1-12(52-14)13-2-4-15(53-13)22(19-8-6-17(20)55-19)25-30(44)34(48)37(51)35(49)31(25)45/h1-9,52,54-55H/b13-12-,20-16+,20-17+,21-14+,21-18+,22-15+,22-19+ |
| InChIKey | SGDZUGSHDNMKQI-LLXWVGLBSA-N |
| XLogP | 11.64 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.50 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|