About 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene
5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene (PubChem CID 162662607) has the molecular formula C19H17FO3S
and a molecular weight of 344.41 g/mol. Its IUPAC name is 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene.
Molecular Properties
| Compound Name | 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene |
| PubChem CID | 162662607 |
| Molecular Formula | C19H17FO3S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene |
| SMILES | COc1cc(/C=C\c2cc3cc(F)ccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17FO3S/c1-21-16-8-12(9-17(22-2)19(16)23-3)4-6-15-11-13-10-14(20)5-7-18(13)24-15/h4-11H,1-3H3/b6-4- |
| InChIKey | JFQFQAFZDJJPBB-XQRVVYSFSA-N |
| XLogP | 5.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
The IUPAC name of 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene (CID 162662607) is 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene.
What is the SMILES notation for 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
The canonical SMILES for 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene is COc1cc(/C=C\c2cc3cc(F)ccc3s2)cc(OC)c1OC.
What is the InChIKey of 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
The InChIKey is JFQFQAFZDJJPBB-XQRVVYSFSA-N. The full InChI is InChI=1S/C19H17FO3S/c1-21-16-8-12(9-17(22-2)19(16)23-3)4-6-15-11-13-10-14(20)5-7-18(13)24-15/h4-11H,1-3H3/b6-4-.
What are the key properties of 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene?
5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene has a molecular weight of 344.41 g/mol, XLogP of 5.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene is sourced from PubChem (CID 162662607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).