C48H33Cl4N5 — CID 162662696
5,10,15,20-tetrakis(4-chlorophenyl)-7-pyrrolidin-1-yl-21,23-dihydroporphyrin (PubChem CID 162662696) has the molecular formula C48H33Cl4N5 and a molecular weight of 821.64 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-chlorophenyl)-7-pyrrolidin-1-yl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-chlorophenyl)-7-pyrrolidin-1-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 162662696 |
| Molecular Formula | C48H33Cl4N5 |
| Molecular Weight | 821.64 g/mol |
| Exact Mass | 819.15 |
| IUPAC Name | 5,10,15,20-tetrakis(4-chlorophenyl)-7-pyrrolidin-1-yl-21,23-dihydroporphyrin |
| SMILES | Clc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[nH]5)C=C4N2CCCC2)C=C3)cc1 |
| InChI | InChI=1S/C48H33Cl4N5/c49-32-11-3-28(4-12-32)44-36-19-20-37(53-36)45(29-5-13-33(50)14-6-29)39-23-24-41(55-39)47(31-9-17-35(52)18-10-31)48-43(57-25-1-2-26-57)27-42(56-48)46(40-22-21-38(44)54-40)30-7-15-34(51)16-8-30/h3-24,27,54-55H,1-2,25-26H2/b44-36-,44-38-,45-37-,45-39-,46-40-,46-42-,47-41-,48-47- |
| InChIKey | GIOAZDGPXTYLCP-ZDMNOSTMSA-N |
| XLogP | 14.36 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.64 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |