C19H14N2O3S — CID 162662896
4-(3-hydroxy-5-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-benzo[h]quinazoline-5,6-dione (PubChem CID 162662896) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-(3-hydroxy-5-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-benzo[h]quinazoline-5,6-dione.
| Compound Name | 4-(3-hydroxy-5-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-benzo[h]quinazoline-5,6-dione |
|---|---|
| PubChem CID | 162662896 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-(3-hydroxy-5-methylphenyl)-2-sulfanylidene-3,4-dihydro-1H-benzo[h]quinazoline-5,6-dione |
| SMILES | Cc1cc(O)cc(C2NC(=S)NC3=C2C(=O)C(=O)c2ccccc23)c1 |
| InChI | InChI=1S/C19H14N2O3S/c1-9-6-10(8-11(22)7-9)15-14-16(21-19(25)20-15)12-4-2-3-5-13(12)17(23)18(14)24/h2-8,15,22H,1H3,(H2,20,21,25) |
| InChIKey | LTADLNRBXQNKGI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|