C19H20O7 — CID 162662926
[(3S,8R,9E,12R)-3-hydroxy-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-5-yl]methyl 2-methylprop-2-enoate (PubChem CID 162662926) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is [(3S,8R,9E,12R)-3-hydroxy-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-5-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(3S,8R,9E,12R)-3-hydroxy-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-5-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162662926 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [(3S,8R,9E,12R)-3-hydroxy-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-5-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1=C2[C@@H](O)CC3=C[C@@H](C/C(C)=C/[C@H]2OC1=O)OC3=O |
| InChI | InChI=1S/C19H20O7/c1-9(2)17(21)24-8-13-16-14(20)7-11-6-12(25-18(11)22)4-10(3)5-15(16)26-19(13)23/h5-6,12,14-15,20H,1,4,7-8H2,2-3H3/b10-5+/t12-,14+,15-/m1/s1 |
| InChIKey | RSZGBELYPNNBKA-GVELVIGYSA-N |
| XLogP | 1.28 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|