C29H38N4O6 — CID 162663027
6-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxyhexanamide (PubChem CID 162663027) has the molecular formula C29H38N4O6 and a molecular weight of 538.65 g/mol. Its IUPAC name is 6-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxyhexanamide.
| Compound Name | 6-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 162663027 |
| Molecular Formula | C29H38N4O6 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 6-[4-[5,7-dimethoxy-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-2,6-dimethylphenoxy]-N-hydroxyhexanamide |
| SMILES | COc1cc(OC)c2c(N3CCOC[C@H]3C)nc(-c3cc(C)c(OCCCCCC(=O)NO)c(C)c3)nc2c1 |
| InChI | InChI=1S/C29H38N4O6/c1-18-13-21(14-19(2)27(18)39-11-8-6-7-9-25(34)32-35)28-30-23-15-22(36-4)16-24(37-5)26(23)29(31-28)33-10-12-38-17-20(33)3/h13-16,20,35H,6-12,17H2,1-5H3,(H,32,34)/t20-/m1/s1 |
| InChIKey | HKGDENCCLQSETC-HXUWFJFHSA-N |
| XLogP | 4.60 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|