C34H39N7O3 — CID 162663125
5-amino-N-[[4-[[(2S)-4-cyclohexyl-1-oxo-1-(pyridin-2-ylmethylamino)butan-2-yl]carbamoyl]phenyl]methyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 162663125) has the molecular formula C34H39N7O3 and a molecular weight of 593.73 g/mol. Its IUPAC name is 5-amino-N-[[4-[[(2S)-4-cyclohexyl-1-oxo-1-(pyridin-2-ylmethylamino)butan-2-yl]carbamoyl]phenyl]methyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[[4-[[(2S)-4-cyclohexyl-1-oxo-1-(pyridin-2-ylmethylamino)butan-2-yl]carbamoyl]phenyl]methyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162663125 |
| Molecular Formula | C34H39N7O3 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | 5-amino-N-[[4-[[(2S)-4-cyclohexyl-1-oxo-1-(pyridin-2-ylmethylamino)butan-2-yl]carbamoyl]phenyl]methyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccc(C(=O)N[C@@H](CCC3CCCCC3)C(=O)NCc3ccccn3)cc2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C34H39N7O3/c35-31-29(23-39-41(31)28-12-5-2-6-13-28)33(43)37-21-25-14-17-26(18-15-25)32(42)40-30(19-16-24-9-3-1-4-10-24)34(44)38-22-27-11-7-8-20-36-27/h2,5-8,11-15,17-18,20,23-24,30H,1,3-4,9-10,16,19,21-22,35H2,(H,37,43)(H,38,44)(H,40,42)/t30-/m0/s1 |
| InChIKey | QHPTXYRWAYRPMZ-PMERELPUSA-N |
| XLogP | 4.55 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |