C40H45N9O6 — CID 162663141
7-cyclopentyl-2-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylcarbamoyl]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 162663141) has the molecular formula C40H45N9O6 and a molecular weight of 747.86 g/mol. Its IUPAC name is 7-cyclopentyl-2-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylcarbamoyl]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopentyl-2-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylcarbamoyl]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 162663141 |
| Molecular Formula | C40H45N9O6 |
| Molecular Weight | 747.86 g/mol |
| Exact Mass | 747.35 |
| IUPAC Name | 7-cyclopentyl-2-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylcarbamoyl]anilino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(C(=O)NCCCCCCNc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C40H45N9O6/c1-47(2)38(54)31-22-25-23-43-40(46-34(25)48(31)27-10-5-6-11-27)44-26-16-14-24(15-17-26)35(51)42-21-8-4-3-7-20-41-29-13-9-12-28-33(29)39(55)49(37(28)53)30-18-19-32(50)45-36(30)52/h9,12-17,22-23,27,30,41H,3-8,10-11,18-21H2,1-2H3,(H,42,51)(H,43,44,46)(H,45,50,52) |
| InChIKey | FXBLKBBIMNXIPV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 187.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|