C18H14N4O2 — CID 162663177
ethyl 4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)benzoate (PubChem CID 162663177) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is ethyl 4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)benzoate.
| Compound Name | ethyl 4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)benzoate |
|---|---|
| PubChem CID | 162663177 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | ethyl 4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cnc3c4cccnc4nn3c2)cc1 |
| InChI | InChI=1S/C18H14N4O2/c1-2-24-18(23)13-7-5-12(6-8-13)14-10-20-17-15-4-3-9-19-16(15)21-22(17)11-14/h3-11H,2H2,1H3 |
| InChIKey | BJGUNPHAGGXHRU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |