About 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine
10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine (PubChem CID 162663197) has the molecular formula C19H22N6O2
and a molecular weight of 366.43 g/mol. Its IUPAC name is 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine.
Molecular Properties
| Compound Name | 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine |
| PubChem CID | 162663197 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine |
| SMILES | O=[N+]([O-])c1c2ccncc2cc2cnc(NCCCN3CCCCC3)nc12 |
| InChI | InChI=1S/C19H22N6O2/c26-25(27)18-16-5-7-20-12-14(16)11-15-13-22-19(23-17(15)18)21-6-4-10-24-8-2-1-3-9-24/h5,7,11-13H,1-4,6,8-10H2,(H,21,22,23) |
| InChIKey | VTGJUJAOYNGWLM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine?
The IUPAC name of 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine (CID 162663197) is 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine.
What is the SMILES notation for 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine?
The canonical SMILES for 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine is O=[N+]([O-])c1c2ccncc2cc2cnc(NCCCN3CCCCC3)nc12.
What is the InChIKey of 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine?
The InChIKey is VTGJUJAOYNGWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6O2/c26-25(27)18-16-5-7-20-12-14(16)11-15-13-22-19(23-17(15)18)21-6-4-10-24-8-2-1-3-9-24/h5,7,11-13H,1-4,6,8-10H2,(H,21,22,23).
What are the key properties of 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine?
10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine has a molecular weight of 366.43 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 10-nitro-N-(3-piperidin-1-ylpropyl)pyrido[3,4-g]quinazolin-2-amine is sourced from PubChem (CID 162663197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).