C21H18F2N6O2 — CID 162663215
1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea (PubChem CID 162663215) has the molecular formula C21H18F2N6O2 and a molecular weight of 424.41 g/mol. Its IUPAC name is 1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 162663215 |
| Molecular Formula | C21H18F2N6O2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea |
| SMILES | C[C@@H](Nc1ccn2ncc(NC(=O)Nc3ccc(O)cc3)c2n1)c1cc(F)ccc1F |
| InChI | InChI=1S/C21H18F2N6O2/c1-12(16-10-13(22)2-7-17(16)23)25-19-8-9-29-20(28-19)18(11-24-29)27-21(31)26-14-3-5-15(30)6-4-14/h2-12,30H,1H3,(H,25,28)(H2,26,27,31)/t12-/m1/s1 |
| InChIKey | XUWIELJQTJFGEY-GFCCVEGCSA-N |
| XLogP | 4.53 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|