C15H16O5 — CID 162663272
(3S,7R,8E,10R,12R)-10-hydroxy-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione (PubChem CID 162663272) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (3S,7R,8E,10R,12R)-10-hydroxy-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione.
| Compound Name | (3S,7R,8E,10R,12R)-10-hydroxy-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione |
|---|---|
| PubChem CID | 162663272 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (3S,7R,8E,10R,12R)-10-hydroxy-10-methyl-6-methylidene-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione |
| SMILES | C=C1C(=O)O[C@H]2CC3=C[C@@H](C[C@@](C)(O)/C=C/[C@H]12)OC3=O |
| InChI | InChI=1S/C15H16O5/c1-8-11-3-4-15(2,18)7-10-5-9(14(17)19-10)6-12(11)20-13(8)16/h3-5,10-12,18H,1,6-7H2,2H3/b4-3+/t10-,11+,12-,15-/m0/s1 |
| InChIKey | DIOKUCNWNFHLAB-NRGWLUSISA-N |
| XLogP | 1.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|