C21H26N2O3 — CID 162663416
2-morpholin-4-yl-5-[(2,4,6-trimethylphenyl)methylamino]benzoic acid (PubChem CID 162663416) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-[(2,4,6-trimethylphenyl)methylamino]benzoic acid.
| Compound Name | 2-morpholin-4-yl-5-[(2,4,6-trimethylphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 162663416 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-morpholin-4-yl-5-[(2,4,6-trimethylphenyl)methylamino]benzoic acid |
| SMILES | Cc1cc(C)c(CNc2ccc(N3CCOCC3)c(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-14-10-15(2)19(16(3)11-14)13-22-17-4-5-20(18(12-17)21(24)25)23-6-8-26-9-7-23/h4-5,10-12,22H,6-9,13H2,1-3H3,(H,24,25) |
| InChIKey | RLHPTZZIEBYEHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|