C20H34O2 — CID 162663431
(3R,3aR,5aS,6S,9aR,10aR)-5a,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5,6,7,9a,10-octahydro-1H-benzo[f]azulene-3,6-diol (PubChem CID 162663431) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (3R,3aR,5aS,6S,9aR,10aR)-5a,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5,6,7,9a,10-octahydro-1H-benzo[f]azulene-3,6-diol.
| Compound Name | (3R,3aR,5aS,6S,9aR,10aR)-5a,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5,6,7,9a,10-octahydro-1H-benzo[f]azulene-3,6-diol |
|---|---|
| PubChem CID | 162663431 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (3R,3aR,5aS,6S,9aR,10aR)-5a,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5,6,7,9a,10-octahydro-1H-benzo[f]azulene-3,6-diol |
| SMILES | CC1=CC[C@H](O)[C@@]2(C)CC[C@@H]3[C@](C)(CC[C@@]3(O)C(C)C)C[C@H]12 |
| InChI | InChI=1S/C20H34O2/c1-13(2)20(22)11-10-18(4)12-15-14(3)6-7-17(21)19(15,5)9-8-16(18)20/h6,13,15-17,21-22H,7-12H2,1-5H3/t15-,16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | VREBFPVOIRCFAO-BOQPXBONSA-N |
| XLogP | 4.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|