About 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol
2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol (PubChem CID 162663445) has the molecular formula C25H26N4O
and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol |
| PubChem CID | 162663445 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol |
| SMILES | Cc1ccc(C)c(Nc2c(C)cnc3ccc(-c4cnc(C(C)(C)O)nc4)cc23)c1 |
| InChI | InChI=1S/C25H26N4O/c1-15-6-7-16(2)22(10-15)29-23-17(3)12-26-21-9-8-18(11-20(21)23)19-13-27-24(28-14-19)25(4,5)30/h6-14,30H,1-5H3,(H,26,29) |
| InChIKey | HQSQJEHUENMAJY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol?
The IUPAC name of 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol (CID 162663445) is 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol.
What is the SMILES notation for 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol?
The canonical SMILES for 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol is Cc1ccc(C)c(Nc2c(C)cnc3ccc(-c4cnc(C(C)(C)O)nc4)cc23)c1.
What is the InChIKey of 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol?
The InChIKey is HQSQJEHUENMAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N4O/c1-15-6-7-16(2)22(10-15)29-23-17(3)12-26-21-9-8-18(11-20(21)23)19-13-27-24(28-14-19)25(4,5)30/h6-14,30H,1-5H3,(H,26,29).
What are the key properties of 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol?
2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol has a molecular weight of 398.51 g/mol, XLogP of 5.59, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[4-(2,5-dimethylanilino)-3-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol is sourced from PubChem (CID 162663445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).